C20H22N4OS2 — CID 152797757
2-(2-amino-5-thiophen-2-ylphenyl)-1-(4-methyl-2-piperazin-1-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 152797757) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-(2-amino-5-thiophen-2-ylphenyl)-1-(4-methyl-2-piperazin-1-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 2-(2-amino-5-thiophen-2-ylphenyl)-1-(4-methyl-2-piperazin-1-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 152797757 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-(2-amino-5-thiophen-2-ylphenyl)-1-(4-methyl-2-piperazin-1-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1nc(N2CCNCC2)sc1C(=O)Cc1cc(-c2cccs2)ccc1N |
| InChI | InChI=1S/C20H22N4OS2/c1-13-19(27-20(23-13)24-8-6-22-7-9-24)17(25)12-15-11-14(4-5-16(15)21)18-3-2-10-26-18/h2-5,10-11,22H,6-9,12,21H2,1H3 |
| InChIKey | SMOWNBOFACWPTE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|