C13H19N5S — CID 70537326
2-piperazin-1-yl-6-propylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 70537326) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 2-piperazin-1-yl-6-propylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-piperazin-1-yl-6-propylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70537326 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-piperazin-1-yl-6-propylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCc1cc2c(N)nc(N3CCNCC3)nc2s1 |
| InChI | InChI=1S/C13H19N5S/c1-2-3-9-8-10-11(14)16-13(17-12(10)19-9)18-6-4-15-5-7-18/h8,15H,2-7H2,1H3,(H2,14,16,17) |
| InChIKey | TZAAWGFAFGGEFN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |