C11H14N6 — CID 175939042
2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 175939042) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175939042 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(N2CCNCC2)nc2cnccc12 |
| InChI | InChI=1S/C11H14N6/c12-10-8-1-2-14-7-9(8)15-11(16-10)17-5-3-13-4-6-17/h1-2,7,13H,3-6H2,(H2,12,15,16) |
| InChIKey | GNAWIDBHLRWXOF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |