C14H19N5 — CID 158357894
6,7-dimethyl-2-piperazin-1-ylquinazolin-4-amine (PubChem CID 158357894) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 6,7-dimethyl-2-piperazin-1-ylquinazolin-4-amine.
| Compound Name | 6,7-dimethyl-2-piperazin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 158357894 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 6,7-dimethyl-2-piperazin-1-ylquinazolin-4-amine |
| SMILES | Cc1cc2nc(N3CCNCC3)nc(N)c2cc1C |
| InChI | InChI=1S/C14H19N5/c1-9-7-11-12(8-10(9)2)17-14(18-13(11)15)19-5-3-16-4-6-19/h7-8,16H,3-6H2,1-2H3,(H2,15,17,18) |
| InChIKey | RDYHCHLITQNGNZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |