C11H14N2OS — CID 57164201
2,6-diethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 57164201) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2,6-diethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2,6-diethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 57164201 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2,6-diethyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1nc2sc(CC)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N2OS/c1-4-7-6(3)9-10(14)12-8(5-2)13-11(9)15-7/h4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | KIYUOFISDXVTCG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |