C10H12N2S2 — CID 18524351
2-ethyl-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-4-thione (PubChem CID 18524351) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-ethyl-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-4-thione.
| Compound Name | 2-ethyl-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 18524351 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-ethyl-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-4-thione |
| SMILES | CCc1nc2sc(C)c(C)c2c(=S)[nH]1 |
| InChI | InChI=1S/C10H12N2S2/c1-4-7-11-9(13)8-5(2)6(3)14-10(8)12-7/h4H2,1-3H3,(H,11,12,13) |
| InChIKey | MTGVIRMYGPOATK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|