C8H9N3S2 — CID 712738
4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-2-thione (PubChem CID 712738) has the molecular formula C8H9N3S2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 712738 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-amino-5,6-dimethyl-3H-thieno[2,3-d]pyrimidine-2-thione |
| SMILES | Cc1sc2nc(=S)[nH]c(N)c2c1C |
| InChI | InChI=1S/C8H9N3S2/c1-3-4(2)13-7-5(3)6(9)10-8(12)11-7/h1-2H3,(H3,9,10,11,12) |
| InChIKey | KCZSGPQKADVYRE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|