C14H14N4OS2 — CID 100991747
2-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 100991747) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 100991747 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-(4,6-dimethyl-2-sulfanylidene-1H-pyrimidin-5-yl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc(=S)[nH]c(C)c1-c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N4OS2/c1-5-8(4)21-13-9(5)12(19)17-11(18-13)10-6(2)15-14(20)16-7(10)3/h1-4H3,(H,15,16,20)(H,17,18,19) |
| InChIKey | VVJLLBRNHAMSPS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|