C14H10I2N2O2S — CID 137064460
2-(4-hydroxy-3,5-diiodophenyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 137064460) has the molecular formula C14H10I2N2O2S and a molecular weight of 524.12 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-diiodophenyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-hydroxy-3,5-diiodophenyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137064460 |
| Molecular Formula | C14H10I2N2O2S |
| Molecular Weight | 524.12 g/mol |
| Exact Mass | 523.86 |
| IUPAC Name | 2-(4-hydroxy-3,5-diiodophenyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(-c3cc(I)c(O)c(I)c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C14H10I2N2O2S/c1-5-6(2)21-14-10(5)13(20)17-12(18-14)7-3-8(15)11(19)9(16)4-7/h3-4,19H,1-2H3,(H,17,18,20) |
| InChIKey | XAWICTNPDCBOJL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|