C10H13N5OS2 — CID 139237256
1-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)amino]-3-methylthiourea (PubChem CID 139237256) has the molecular formula C10H13N5OS2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)amino]-3-methylthiourea.
| Compound Name | 1-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)amino]-3-methylthiourea |
|---|---|
| PubChem CID | 139237256 |
| Molecular Formula | C10H13N5OS2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)amino]-3-methylthiourea |
| SMILES | CNC(=S)NNc1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N5OS2/c1-4-5(2)18-8-6(4)7(16)12-9(13-8)14-15-10(17)11-3/h1-3H3,(H2,11,15,17)(H2,12,13,14,16) |
| InChIKey | UGAMFGWQLCSCHQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|