C18H14BrNO5 — CID 1307439
[3-(2-bromophenoxy)-4-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 1307439) has the molecular formula C18H14BrNO5 and a molecular weight of 404.22 g/mol. Its IUPAC name is [3-(2-bromophenoxy)-4-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-(2-bromophenoxy)-4-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 1307439 |
| Molecular Formula | C18H14BrNO5 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | [3-(2-bromophenoxy)-4-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2c(=O)c(Oc3ccccc3Br)coc2c1 |
| InChI | InChI=1S/C18H14BrNO5/c1-20(2)18(22)24-11-7-8-12-15(9-11)23-10-16(17(12)21)25-14-6-4-3-5-13(14)19/h3-10H,1-2H3 |
| InChIKey | MTNMAUACXVEEMH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |