C10H10BrNO3 — CID 130747006
1-[(5-bromofuran-3-yl)methyl]piperidine-2,4-dione (PubChem CID 130747006) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is 1-[(5-bromofuran-3-yl)methyl]piperidine-2,4-dione.
| Compound Name | 1-[(5-bromofuran-3-yl)methyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 130747006 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 1-[(5-bromofuran-3-yl)methyl]piperidine-2,4-dione |
| SMILES | O=C1CCN(Cc2coc(Br)c2)C(=O)C1 |
| InChI | InChI=1S/C10H10BrNO3/c11-9-3-7(6-15-9)5-12-2-1-8(13)4-10(12)14/h3,6H,1-2,4-5H2 |
| InChIKey | LOORHXYILWIDAU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|