C10H12F2N2 — CID 130748594
3,5-difluoro-2-[(2R)-piperidin-2-yl]pyridine (PubChem CID 130748594) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,5-difluoro-2-[(2R)-piperidin-2-yl]pyridine.
| Compound Name | 3,5-difluoro-2-[(2R)-piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 130748594 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3,5-difluoro-2-[(2R)-piperidin-2-yl]pyridine |
| SMILES | Fc1cnc([C@H]2CCCCN2)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2/c11-7-5-8(12)10(14-6-7)9-3-1-2-4-13-9/h5-6,9,13H,1-4H2/t9-/m1/s1 |
| InChIKey | AMZQXIQMCIBQMJ-SECBINFHSA-N |
| XLogP | 2.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |