C9H10Cl2N2 — CID 130641922
3,5-dichloro-2-[(2S)-pyrrolidin-2-yl]pyridine (PubChem CID 130641922) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 3,5-dichloro-2-[(2S)-pyrrolidin-2-yl]pyridine.
| Compound Name | 3,5-dichloro-2-[(2S)-pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 130641922 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3,5-dichloro-2-[(2S)-pyrrolidin-2-yl]pyridine |
| SMILES | Clc1cnc([C@@H]2CCCN2)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2/c10-6-4-7(11)9(13-5-6)8-2-1-3-12-8/h4-5,8,12H,1-3H2/t8-/m0/s1 |
| InChIKey | GDKYWZKFGITITI-QMMMGPOBSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |