C10H12Cl3NO — CID 171196064
3,5-dichloro-2-[(2R)-pyrrolidin-2-yl]phenol;hydrochloride (PubChem CID 171196064) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is 3,5-dichloro-2-[(2R)-pyrrolidin-2-yl]phenol;hydrochloride.
| Compound Name | 3,5-dichloro-2-[(2R)-pyrrolidin-2-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171196064 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 3,5-dichloro-2-[(2R)-pyrrolidin-2-yl]phenol;hydrochloride |
| SMILES | Cl.Oc1cc(Cl)cc(Cl)c1[C@H]1CCCN1 |
| InChI | InChI=1S/C10H11Cl2NO.ClH/c11-6-4-7(12)10(9(14)5-6)8-2-1-3-13-8;/h4-5,8,13-14H,1-3H2;1H/t8-;/m1./s1 |
| InChIKey | VRNDSYVBGWAJRG-DDWIOCJRSA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|