C5H11NO4S — CID 130751513
N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide (PubChem CID 130751513) has the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. Its IUPAC name is N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 130751513 |
| Molecular Formula | C5H11NO4S |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H11NO4S/c1-11(8,9)6-4-2-10-3-5(4)7/h4-7H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | LREUSDXNPWYENN-RFZPGFLSSA-N |
| XLogP | -1.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |