C6H12FNO2 — CID 130751543
(3S,4R)-4-(2-fluoroethylamino)oxolan-3-ol (PubChem CID 130751543) has the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. Its IUPAC name is (3S,4R)-4-(2-fluoroethylamino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(2-fluoroethylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 130751543 |
| Molecular Formula | C6H12FNO2 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | (3S,4R)-4-(2-fluoroethylamino)oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NCCF |
| InChI | InChI=1S/C6H12FNO2/c7-1-2-8-5-3-10-4-6(5)9/h5-6,8-9H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | XMOFAEGZZDRBMF-PHDIDXHHSA-N |
| XLogP | -0.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |