C12H14N6O — CID 130757058
(3S,4R)-3-amino-1-(2-benzyltetrazol-5-yl)-4-methylazetidin-2-one (PubChem CID 130757058) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-(2-benzyltetrazol-5-yl)-4-methylazetidin-2-one.
| Compound Name | (3S,4R)-3-amino-1-(2-benzyltetrazol-5-yl)-4-methylazetidin-2-one |
|---|---|
| PubChem CID | 130757058 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (3S,4R)-3-amino-1-(2-benzyltetrazol-5-yl)-4-methylazetidin-2-one |
| SMILES | C[C@@H]1[C@H](N)C(=O)N1c1nnn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H14N6O/c1-8-10(13)11(19)18(8)12-14-16-17(15-12)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3/t8-,10+/m1/s1 |
| InChIKey | FQDMGIKZYOMJAO-SCZZXKLOSA-N |
| XLogP | -0.22 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |