C8H14O2 — CID 130757707
(1S)-1-[(2S,3R)-3-methyloxiran-2-yl]pent-4-en-1-ol (PubChem CID 130757707) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (1S)-1-[(2S,3R)-3-methyloxiran-2-yl]pent-4-en-1-ol.
| Compound Name | (1S)-1-[(2S,3R)-3-methyloxiran-2-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 130757707 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (1S)-1-[(2S,3R)-3-methyloxiran-2-yl]pent-4-en-1-ol |
| SMILES | C=CCC[C@H](O)[C@@H]1O[C@@H]1C |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-7(9)8-6(2)10-8/h3,6-9H,1,4-5H2,2H3/t6-,7+,8-/m1/s1 |
| InChIKey | YNNIFJDDRHKFOY-GJMOJQLCSA-N |
| XLogP | 1.10 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|