C17H24O2 — CID 162866456
(1R)-1-[(2S,3R)-3-hept-6-enyloxiran-2-yl]octa-2,4-diyn-1-ol (PubChem CID 162866456) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R)-1-[(2S,3R)-3-hept-6-enyloxiran-2-yl]octa-2,4-diyn-1-ol.
| Compound Name | (1R)-1-[(2S,3R)-3-hept-6-enyloxiran-2-yl]octa-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 162866456 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1R)-1-[(2S,3R)-3-hept-6-enyloxiran-2-yl]octa-2,4-diyn-1-ol |
| SMILES | C=CCCCCC[C@H]1O[C@H]1[C@H](O)C#CC#CCCC |
| InChI | InChI=1S/C17H24O2/c1-3-5-7-9-11-13-15(18)17-16(19-17)14-12-10-8-6-4-2/h4,15-18H,2-3,5-6,8,10,12,14H2,1H3/t15-,16-,17+/m1/s1 |
| InChIKey | NLFJDDYYSDVHFW-ZACQAIPSSA-N |
| XLogP | 3.06 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|