C8H11F3O3 — CID 135060551
1-[(2S,3R)-3-but-3-enyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol (PubChem CID 135060551) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is 1-[(2S,3R)-3-but-3-enyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-[(2S,3R)-3-but-3-enyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 135060551 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-[(2S,3R)-3-but-3-enyloxiran-2-yl]-2,2,2-trifluoroethane-1,1-diol |
| SMILES | C=CCC[C@H]1O[C@@H]1C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O3/c1-2-3-4-5-6(14-5)7(12,13)8(9,10)11/h2,5-6,12-13H,1,3-4H2/t5-,6+/m1/s1 |
| InChIKey | DRIWXKHOZLJGMW-RITPCOANSA-N |
| XLogP | 0.96 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|