C8H14O2 — CID 14017288
[(2S,3R)-3-pent-4-enyloxiran-2-yl]methanol (PubChem CID 14017288) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is [(2S,3R)-3-pent-4-enyloxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-pent-4-enyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 14017288 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | [(2S,3R)-3-pent-4-enyloxiran-2-yl]methanol |
| SMILES | C=CCCC[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-5-7-8(6-9)10-7/h2,7-9H,1,3-6H2/t7-,8+/m1/s1 |
| InChIKey | YCZNSWCVOLTLPB-SFYZADRCSA-N |
| XLogP | 1.10 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|