About N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride
N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 130762927) has the molecular formula C10H16ClN3O
and a molecular weight of 229.71 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride |
| PubChem CID | 130762927 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)c(C(=O)NC2CC2N)[nH]1.Cl |
| InChI | InChI=1S/C10H15N3O.ClH/c1-5-3-6(2)12-9(5)10(14)13-8-4-7(8)11;/h3,7-8,12H,4,11H2,1-2H3,(H,13,14);1H |
| InChIKey | QTEORGRYEJUXTN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride?
The IUPAC name of N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride (CID 130762927) is N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride.
What is the SMILES notation for N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride?
The canonical SMILES for N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride is Cc1cc(C)c(C(=O)NC2CC2N)[nH]1.Cl.
What is the InChIKey of N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride?
The InChIKey is QTEORGRYEJUXTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O.ClH/c1-5-3-6(2)12-9(5)10(14)13-8-4-7(8)11;/h3,7-8,12H,4,11H2,1-2H3,(H,13,14);1H.
What are the key properties of N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride?
N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride has a molecular weight of 229.71 g/mol, XLogP of 0.88, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxamide;hydrochloride is sourced from PubChem (CID 130762927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).