C10H13NO2 — CID 45116144
1-(3,5-dimethyl-1H-pyrrol-2-yl)butane-1,3-dione (PubChem CID 45116144) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrrol-2-yl)butane-1,3-dione.
| Compound Name | 1-(3,5-dimethyl-1H-pyrrol-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 45116144 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrrol-2-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1[nH]c(C)cc1C |
| InChI | InChI=1S/C10H13NO2/c1-6-4-7(2)11-10(6)9(13)5-8(3)12/h4,11H,5H2,1-3H3 |
| InChIKey | PIBXYFOFERHYQW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|