About pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium)
pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) (PubChem CID 158275345) has the molecular formula C5H8O7V2-10
and a molecular weight of 282.00 g/mol. Its IUPAC name is pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium).
Molecular Properties
| Compound Name | pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) |
| PubChem CID | 158275345 |
| Molecular Formula | C5H8O7V2-10 |
| Molecular Weight | 282.00 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) |
| SMILES | CC(=O)CC(C)=O.[O-2].[O-2].[O-2].[O-2].[O-2].[V].[V] |
| InChI | InChI=1S/C5H8O2.5O.2V/c1-4(6)3-5(2)7;;;;;;;/h3H2,1-2H3;;;;;;;/q;5*-2;; |
| InChIKey | MXSZSAFHTDTAAZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 176.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.00 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium)?
The IUPAC name of pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) (CID 158275345) is pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium).
What is the SMILES notation for pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium)?
The canonical SMILES for pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) is CC(=O)CC(C)=O.[O-2].[O-2].[O-2].[O-2].[O-2].[V].[V].
What is the InChIKey of pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium)?
The InChIKey is MXSZSAFHTDTAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.5O.2V/c1-4(6)3-5(2)7;;;;;;;/h3H2,1-2H3;;;;;;;/q;5*-2;;.
What are the key properties of pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium)?
pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) has a molecular weight of 282.00 g/mol, XLogP of -0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentakis(oxygen(2-));pentane-2,4-dione;bis(vanadium) is sourced from PubChem (CID 158275345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).