C7H11NOS — CID 130763527
(1S,5S)-1-hydroxy-6-azabicyclo[3.2.1]octane-7-thione (PubChem CID 130763527) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is (1S,5S)-1-hydroxy-6-azabicyclo[3.2.1]octane-7-thione.
| Compound Name | (1S,5S)-1-hydroxy-6-azabicyclo[3.2.1]octane-7-thione |
|---|---|
| PubChem CID | 130763527 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | (1S,5S)-1-hydroxy-6-azabicyclo[3.2.1]octane-7-thione |
| SMILES | O[C@@]12CCC[C@@H](C1)NC2=S |
| InChI | InChI=1S/C7H11NOS/c9-7-3-1-2-5(4-7)8-6(7)10/h5,9H,1-4H2,(H,8,10)/t5-,7-/m0/s1 |
| InChIKey | MGXJCRFVJONJLG-FSPLSTOPSA-N |
| XLogP | 0.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|