C6H11NOS — CID 55299995
(3R,5R)-3-hydroxy-3,5-dimethylpyrrolidine-2-thione (PubChem CID 55299995) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is (3R,5R)-3-hydroxy-3,5-dimethylpyrrolidine-2-thione.
| Compound Name | (3R,5R)-3-hydroxy-3,5-dimethylpyrrolidine-2-thione |
|---|---|
| PubChem CID | 55299995 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | (3R,5R)-3-hydroxy-3,5-dimethylpyrrolidine-2-thione |
| SMILES | C[C@@H]1C[C@@](C)(O)C(=S)N1 |
| InChI | InChI=1S/C6H11NOS/c1-4-3-6(2,8)5(9)7-4/h4,8H,3H2,1-2H3,(H,7,9)/t4-,6-/m1/s1 |
| InChIKey | QWLOLJOHXJANIA-INEUFUBQSA-N |
| XLogP | 0.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|