C5H7NS2 — CID 137473196
5-methylpyrrolidine-2,4-dithione (PubChem CID 137473196) has the molecular formula C5H7NS2 and a molecular weight of 145.25 g/mol. Its IUPAC name is 5-methylpyrrolidine-2,4-dithione.
| Compound Name | 5-methylpyrrolidine-2,4-dithione |
|---|---|
| PubChem CID | 137473196 |
| Molecular Formula | C5H7NS2 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.00 |
| IUPAC Name | 5-methylpyrrolidine-2,4-dithione |
| SMILES | CC1NC(=S)CC1=S |
| InChI | InChI=1S/C5H7NS2/c1-3-4(7)2-5(8)6-3/h3H,2H2,1H3,(H,6,8) |
| InChIKey | VUODLDUZXHEZLF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|