C5H11N3S — CID 72728890
6-amino-2-methyl-1,3-diazinane-4-thione (PubChem CID 72728890) has the molecular formula C5H11N3S and a molecular weight of 145.23 g/mol. Its IUPAC name is 6-amino-2-methyl-1,3-diazinane-4-thione.
| Compound Name | 6-amino-2-methyl-1,3-diazinane-4-thione |
|---|---|
| PubChem CID | 72728890 |
| Molecular Formula | C5H11N3S |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 6-amino-2-methyl-1,3-diazinane-4-thione |
| SMILES | CC1NC(=S)CC(N)N1 |
| InChI | InChI=1S/C5H11N3S/c1-3-7-4(6)2-5(9)8-3/h3-4,7H,2,6H2,1H3,(H,8,9) |
| InChIKey | OKWYQRORSONMHT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|