C4H9N3S — CID 78350195
2-amino-1,3-diazinane-4-thione (PubChem CID 78350195) has the molecular formula C4H9N3S and a molecular weight of 131.20 g/mol. Its IUPAC name is 2-amino-1,3-diazinane-4-thione.
| Compound Name | 2-amino-1,3-diazinane-4-thione |
|---|---|
| PubChem CID | 78350195 |
| Molecular Formula | C4H9N3S |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 2-amino-1,3-diazinane-4-thione |
| SMILES | NC1NCCC(=S)N1 |
| InChI | InChI=1S/C4H9N3S/c5-4-6-2-1-3(8)7-4/h4,6H,1-2,5H2,(H,7,8) |
| InChIKey | OSIVIFMTFZBIKC-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|