C3H10N4O2 — CID 73449560
4-amino-1,3,5-triazinan-2-one;hydrate (PubChem CID 73449560) has the molecular formula C3H10N4O2 and a molecular weight of 134.14 g/mol. Its IUPAC name is 4-amino-1,3,5-triazinan-2-one;hydrate.
| Compound Name | 4-amino-1,3,5-triazinan-2-one;hydrate |
|---|---|
| PubChem CID | 73449560 |
| Molecular Formula | C3H10N4O2 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4-amino-1,3,5-triazinan-2-one;hydrate |
| SMILES | NC1NCNC(=O)N1.O |
| InChI | InChI=1S/C3H8N4O.H2O/c4-2-5-1-6-3(8)7-2;/h2,5H,1,4H2,(H2,6,7,8);1H2 |
| InChIKey | TVCZXQJTOMXQGJ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |