C4H8BrN3O — CID 56624234
4-amino-5-bromo-1,3-diazinan-2-one (PubChem CID 56624234) has the molecular formula C4H8BrN3O and a molecular weight of 194.03 g/mol. Its IUPAC name is 4-amino-5-bromo-1,3-diazinan-2-one.
| Compound Name | 4-amino-5-bromo-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 56624234 |
| Molecular Formula | C4H8BrN3O |
| Molecular Weight | 194.03 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | 4-amino-5-bromo-1,3-diazinan-2-one |
| SMILES | NC1NC(=O)NCC1Br |
| InChI | InChI=1S/C4H8BrN3O/c5-2-1-7-4(9)8-3(2)6/h2-3H,1,6H2,(H2,7,8,9) |
| InChIKey | RPHPOLCIBOFZMI-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.03 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|