C4H10N4O — CID 91270035
5-amino-6-methyl-1,2,4-triazinan-3-one (PubChem CID 91270035) has the molecular formula C4H10N4O and a molecular weight of 130.15 g/mol. Its IUPAC name is 5-amino-6-methyl-1,2,4-triazinan-3-one.
| Compound Name | 5-amino-6-methyl-1,2,4-triazinan-3-one |
|---|---|
| PubChem CID | 91270035 |
| Molecular Formula | C4H10N4O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 5-amino-6-methyl-1,2,4-triazinan-3-one |
| SMILES | CC1NNC(=O)NC1N |
| InChI | InChI=1S/C4H10N4O/c1-2-3(5)6-4(9)8-7-2/h2-3,7H,5H2,1H3,(H2,6,8,9) |
| InChIKey | SQRPBEFBQUAIGT-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |