About 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one
6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one (PubChem CID 89029119) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one.
Analyze 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one?
The IUPAC name of 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one (CID 89029119) is 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one.
What is the SMILES notation for 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one?
The canonical SMILES for 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one is CC1C2NC(=O)NC1C2N.
What is the InChIKey of 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one?
The InChIKey is KVBHUGLGKRHBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-2-4-3(7)5(2)9-6(10)8-4/h2-5H,7H2,1H3,(H2,8,9,10).
What are the key properties of 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one?
6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one has a molecular weight of 141.17 g/mol, XLogP of -0.99, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7-methyl-2,4-diazabicyclo[3.1.1]heptan-3-one is sourced from PubChem (CID 89029119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).