C11H11F3N2S — CID 145079064
6-(5-amino-2-fluorophenyl)-5,5-difluoropiperidine-2-thione (PubChem CID 145079064) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 6-(5-amino-2-fluorophenyl)-5,5-difluoropiperidine-2-thione.
| Compound Name | 6-(5-amino-2-fluorophenyl)-5,5-difluoropiperidine-2-thione |
|---|---|
| PubChem CID | 145079064 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 6-(5-amino-2-fluorophenyl)-5,5-difluoropiperidine-2-thione |
| SMILES | Nc1ccc(F)c(C2NC(=S)CCC2(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2S/c12-8-2-1-6(15)5-7(8)10-11(13,14)4-3-9(17)16-10/h1-2,5,10H,3-4,15H2,(H,16,17) |
| InChIKey | DRYVVFUDJHYPFE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|