C13H15F3N2S — CID 121334893
(3S,5S,6R)-6-(5-amino-2-fluorophenyl)-3,5-difluoro-3,6-dimethylpiperidine-2-thione (PubChem CID 121334893) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is (3S,5S,6R)-6-(5-amino-2-fluorophenyl)-3,5-difluoro-3,6-dimethylpiperidine-2-thione.
| Compound Name | (3S,5S,6R)-6-(5-amino-2-fluorophenyl)-3,5-difluoro-3,6-dimethylpiperidine-2-thione |
|---|---|
| PubChem CID | 121334893 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (3S,5S,6R)-6-(5-amino-2-fluorophenyl)-3,5-difluoro-3,6-dimethylpiperidine-2-thione |
| SMILES | C[C@]1(F)C[C@H](F)[C@@](C)(c2cc(N)ccc2F)NC1=S |
| InChI | InChI=1S/C13H15F3N2S/c1-12(16)6-10(15)13(2,18-11(12)19)8-5-7(17)3-4-9(8)14/h3-5,10H,6,17H2,1-2H3,(H,18,19)/t10-,12-,13+/m0/s1 |
| InChIKey | AOAXKFIRJMONKK-WCFLWFBJSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|