C15H17F4N3O — CID 163824585
3-[3-cyclopropyl-5-methylimino-2-(trifluoromethyl)morpholin-3-yl]-4-fluoroaniline (PubChem CID 163824585) has the molecular formula C15H17F4N3O and a molecular weight of 331.31 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-methylimino-2-(trifluoromethyl)morpholin-3-yl]-4-fluoroaniline.
| Compound Name | 3-[3-cyclopropyl-5-methylimino-2-(trifluoromethyl)morpholin-3-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 163824585 |
| Molecular Formula | C15H17F4N3O |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-[3-cyclopropyl-5-methylimino-2-(trifluoromethyl)morpholin-3-yl]-4-fluoroaniline |
| SMILES | C/N=C1\COC(C(F)(F)F)C(c2cc(N)ccc2F)(C2CC2)N1 |
| InChI | InChI=1S/C15H17F4N3O/c1-21-12-7-23-13(15(17,18)19)14(22-12,8-2-3-8)10-6-9(20)4-5-11(10)16/h4-6,8,13H,2-3,7,20H2,1H3,(H,21,22) |
| InChIKey | NYIXNDNZVKJJPC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|