C19H28FN3O2S — CID 143834695
tert-butyl formate;4-fluoro-3-(2-methylimino-1,4,4a,5,6,7-hexahydrocyclopenta[d][1,3]thiazin-7a-yl)aniline (PubChem CID 143834695) has the molecular formula C19H28FN3O2S and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl formate;4-fluoro-3-(2-methylimino-1,4,4a,5,6,7-hexahydrocyclopenta[d][1,3]thiazin-7a-yl)aniline.
| Compound Name | tert-butyl formate;4-fluoro-3-(2-methylimino-1,4,4a,5,6,7-hexahydrocyclopenta[d][1,3]thiazin-7a-yl)aniline |
|---|---|
| PubChem CID | 143834695 |
| Molecular Formula | C19H28FN3O2S |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl formate;4-fluoro-3-(2-methylimino-1,4,4a,5,6,7-hexahydrocyclopenta[d][1,3]thiazin-7a-yl)aniline |
| SMILES | C/N=C1/NC2(c3cc(N)ccc3F)CCCC2CS1.CC(C)(C)OC=O |
| InChI | InChI=1S/C14H18FN3S.C5H10O2/c1-17-13-18-14(6-2-3-9(14)8-19-13)11-7-10(16)4-5-12(11)15;1-5(2,3)7-4-6/h4-5,7,9H,2-3,6,8,16H2,1H3,(H,17,18);4H,1-3H3 |
| InChIKey | DXKZERZCYJFNDU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|