C27H29F8N3S2 — CID 158238028
(3R,6R)-6-(5-amino-2-fluorophenyl)-3,5,5-trifluoro-3,6-dimethylpiperidine-2-thione;(3R,6R)-3,5,5-trifluoro-6-(2-fluoro-5-methylphenyl)-3,6-dimethylpiperidine-2-thione (PubChem CID 158238028) has the molecular formula C27H29F8N3S2 and a molecular weight of 611.67 g/mol. Its IUPAC name is (3R,6R)-6-(5-amino-2-fluorophenyl)-3,5,5-trifluoro-3,6-dimethylpiperidine-2-thione;(3R,6R)-3,5,5-trifluoro-6-(2-fluoro-5-methylphenyl)-3,6-dimethylpiperidine-2-thione.
| Compound Name | (3R,6R)-6-(5-amino-2-fluorophenyl)-3,5,5-trifluoro-3,6-dimethylpiperidine-2-thione;(3R,6R)-3,5,5-trifluoro-6-(2-fluoro-5-methylphenyl)-3,6-dimethylpiperidine-2-thione |
|---|---|
| PubChem CID | 158238028 |
| Molecular Formula | C27H29F8N3S2 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | (3R,6R)-6-(5-amino-2-fluorophenyl)-3,5,5-trifluoro-3,6-dimethylpiperidine-2-thione;(3R,6R)-3,5,5-trifluoro-6-(2-fluoro-5-methylphenyl)-3,6-dimethylpiperidine-2-thione |
| SMILES | C[C@@]1(F)CC(F)(F)[C@@](C)(c2cc(N)ccc2F)NC1=S.Cc1ccc(F)c([C@@]2(C)NC(=S)[C@](C)(F)CC2(F)F)c1 |
| InChI | InChI=1S/C14H15F4NS.C13H14F4N2S/c1-8-4-5-10(15)9(6-8)13(3)14(17,18)7-12(2,16)11(20)19-13;1-11(15)6-13(16,17)12(2,19-10(11)20)8-5-7(18)3-4-9(8)14/h4-6H,7H2,1-3H3,(H,19,20);3-5H,6,18H2,1-2H3,(H,19,20)/t12-,13-;11-,12-/m11/s1 |
| InChIKey | GFEZTPPDNUUJPE-ZUBMRKGLSA-N |
| XLogP | 7.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|