C6H10N2OS — CID 88817877
5-oxido-3,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium-2-thione (PubChem CID 88817877) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 5-oxido-3,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium-2-thione.
| Compound Name | 5-oxido-3,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium-2-thione |
|---|---|
| PubChem CID | 88817877 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 5-oxido-3,3a,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium-2-thione |
| SMILES | [O-][NH+]1CC2CC(=S)NC2C1 |
| InChI | InChI=1S/C6H10N2OS/c9-8-2-4-1-6(10)7-5(4)3-8/h4-5,8H,1-3H2,(H,7,10) |
| InChIKey | GMIXBGHIOBNHRO-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 39.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|