C8H15N3S — CID 130141413
3-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-2-thione (PubChem CID 130141413) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 3-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-2-thione.
| Compound Name | 3-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-2-thione |
|---|---|
| PubChem CID | 130141413 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-2-thione |
| SMILES | NC1NC2CCCCC2NC1=S |
| InChI | InChI=1S/C8H15N3S/c9-7-8(12)11-6-4-2-1-3-5(6)10-7/h5-7,10H,1-4,9H2,(H,11,12) |
| InChIKey | AINWNCYZWDILAU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|