C9H18N4 — CID 136966018
2-(1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylideneamino)ethanamine (PubChem CID 136966018) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-(1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylideneamino)ethanamine.
| Compound Name | 2-(1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylideneamino)ethanamine |
|---|---|
| PubChem CID | 136966018 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-(1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-ylideneamino)ethanamine |
| SMILES | NCCN=C1NC2CCCCC2N1 |
| InChI | InChI=1S/C9H18N4/c10-5-6-11-9-12-7-3-1-2-4-8(7)13-9/h7-8H,1-6,10H2,(H2,11,12,13) |
| InChIKey | LSGGDKPPUNBABB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|