C31H46N6S — CID 159151082
(3-methylphenyl)methanamine;N-[(3-methylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-imine;2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole (PubChem CID 159151082) has the molecular formula C31H46N6S and a molecular weight of 534.82 g/mol. Its IUPAC name is (3-methylphenyl)methanamine;N-[(3-methylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-imine;2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole.
| Compound Name | (3-methylphenyl)methanamine;N-[(3-methylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-imine;2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 159151082 |
| Molecular Formula | C31H46N6S |
| Molecular Weight | 534.82 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | (3-methylphenyl)methanamine;N-[(3-methylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-2-imine;2-methylsulfanyl-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
| SMILES | CSC1=NC2CCCCC2N1.Cc1cccc(CN)c1.Cc1cccc(CN=C2NC3CCCCC3N2)c1 |
| InChI | InChI=1S/C15H21N3.C8H14N2S.C8H11N/c1-11-5-4-6-12(9-11)10-16-15-17-13-7-2-3-8-14(13)18-15;1-11-8-9-6-4-2-3-5-7(6)10-8;1-7-3-2-4-8(5-7)6-9/h4-6,9,13-14H,2-3,7-8,10H2,1H3,(H2,16,17,18);6-7H,2-5H2,1H3,(H,9,10);2-5H,6,9H2,1H3 |
| InChIKey | KJHIJRTZVSRIOU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|