C14H19ClFN3 — CID 141106255
(3aR,7aS)-N-[(3-fluorophenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 141106255) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is (3aR,7aS)-N-[(3-fluorophenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | (3aR,7aS)-N-[(3-fluorophenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 141106255 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (3aR,7aS)-N-[(3-fluorophenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | Cl.Fc1cccc(CNC2=N[C@@H]3CCCC[C@@H]3N2)c1 |
| InChI | InChI=1S/C14H18FN3.ClH/c15-11-5-3-4-10(8-11)9-16-14-17-12-6-1-2-7-13(12)18-14;/h3-5,8,12-13H,1-2,6-7,9H2,(H2,16,17,18);1H/t12-,13+; |
| InChIKey | YFAJZMLSFZMAMC-OEEJBDNKSA-N |
| XLogP | 2.61 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |