C19H26FN3O2 — CID 68569166
tert-butyl (3aR,7aS)-2-[(3-fluorophenyl)methylamino]-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxylate (PubChem CID 68569166) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is tert-butyl (3aR,7aS)-2-[(3-fluorophenyl)methylamino]-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxylate.
| Compound Name | tert-butyl (3aR,7aS)-2-[(3-fluorophenyl)methylamino]-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 68569166 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl (3aR,7aS)-2-[(3-fluorophenyl)methylamino]-3a,4,5,6,7,7a-hexahydrobenzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(NCc2cccc(F)c2)=N[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H26FN3O2/c1-19(2,3)25-18(24)23-16-10-5-4-9-15(16)22-17(23)21-12-13-7-6-8-14(20)11-13/h6-8,11,15-16H,4-5,9-10,12H2,1-3H3,(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | QJGNHPHUBNDNJT-CVEARBPZSA-N |
| XLogP | 3.83 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |