C6H13N2P — CID 134240480
2,3,3a,4,5,6,7,7a-octahydro-1H-benzo[d][1,3,2]diazaphosphole (PubChem CID 134240480) has the molecular formula C6H13N2P and a molecular weight of 144.16 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-benzo[d][1,3,2]diazaphosphole.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-benzo[d][1,3,2]diazaphosphole |
|---|---|
| PubChem CID | 134240480 |
| Molecular Formula | C6H13N2P |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-benzo[d][1,3,2]diazaphosphole |
| SMILES | C1CCC2NPNC2C1 |
| InChI | InChI=1S/C6H13N2P/c1-2-4-6-5(3-1)7-9-8-6/h5-9H,1-4H2 |
| InChIKey | RLCZKQRCUWIKCC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|