C16H32N4 — CID 67866856
1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine;1,3-diazinane (PubChem CID 67866856) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine;1,3-diazinane.
| Compound Name | 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine;1,3-diazinane |
|---|---|
| PubChem CID | 67866856 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine;1,3-diazinane |
| SMILES | C1CCC2NC3CCCCC3NC2C1.C1CNCNC1 |
| InChI | InChI=1S/C12H22N2.C4H10N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-5-4-6-3-1/h9-14H,1-8H2;5-6H,1-4H2 |
| InChIKey | GTCPBGGJZBKJFC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |