C4H7NSSe — CID 88784380
4-methyl-1,3-selenazolidine-2-thione (PubChem CID 88784380) has the molecular formula C4H7NSSe and a molecular weight of 180.13 g/mol. Its IUPAC name is 4-methyl-1,3-selenazolidine-2-thione.
| Compound Name | 4-methyl-1,3-selenazolidine-2-thione |
|---|---|
| PubChem CID | 88784380 |
| Molecular Formula | C4H7NSSe |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.95 |
| IUPAC Name | 4-methyl-1,3-selenazolidine-2-thione |
| SMILES | CC1C[Se]C(=S)N1 |
| InChI | InChI=1S/C4H7NSSe/c1-3-2-7-4(6)5-3/h3H,2H2,1H3,(H,5,6) |
| InChIKey | GHVZWTMANWLIBM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|