C9H17NOS — CID 3052684
2,2-diethyl-5-methylmorpholine-3-thione (PubChem CID 3052684) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 2,2-diethyl-5-methylmorpholine-3-thione.
| Compound Name | 2,2-diethyl-5-methylmorpholine-3-thione |
|---|---|
| PubChem CID | 3052684 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2,2-diethyl-5-methylmorpholine-3-thione |
| SMILES | CCC1(CC)OCC(C)NC1=S |
| InChI | InChI=1S/C9H17NOS/c1-4-9(5-2)8(12)10-7(3)6-11-9/h7H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | GBKXCITYVPFWCH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|