C5H8N2S3 — CID 71356857
4-methyl-1,3,6-thiadiazepane-2,7-dithione (PubChem CID 71356857) has the molecular formula C5H8N2S3 and a molecular weight of 192.33 g/mol. Its IUPAC name is 4-methyl-1,3,6-thiadiazepane-2,7-dithione.
| Compound Name | 4-methyl-1,3,6-thiadiazepane-2,7-dithione |
|---|---|
| PubChem CID | 71356857 |
| Molecular Formula | C5H8N2S3 |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 4-methyl-1,3,6-thiadiazepane-2,7-dithione |
| SMILES | CC1CNC(=S)SC(=S)N1 |
| InChI | InChI=1S/C5H8N2S3/c1-3-2-6-4(8)10-5(9)7-3/h3H,2H2,1H3,(H,6,8)(H,7,9) |
| InChIKey | QRPUVVYVKYCSEY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|